About 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one
6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 176962970) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
Analyze 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The IUPAC name of 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (CID 176962970) is 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The canonical SMILES for 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is CCC1CCc2nccc(=O)n21.
What is the InChIKey of 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The InChIKey is YIWIWRRJNYWSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-7-3-4-8-10-6-5-9(12)11(7)8/h5-7H,2-4H2,1H3.
What are the key properties of 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one has a molecular weight of 164.21 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 176962970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).