C31H23N3O2 — CID 142094227
4-[[4-cyano-3-naphthalen-1-yl-N-(pyridin-3-ylmethyl)anilino]methyl]benzoic acid (PubChem CID 142094227) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[[4-cyano-3-naphthalen-1-yl-N-(pyridin-3-ylmethyl)anilino]methyl]benzoic acid.
| Compound Name | 4-[[4-cyano-3-naphthalen-1-yl-N-(pyridin-3-ylmethyl)anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 142094227 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-[[4-cyano-3-naphthalen-1-yl-N-(pyridin-3-ylmethyl)anilino]methyl]benzoic acid |
| SMILES | N#Cc1ccc(N(Cc2ccc(C(=O)O)cc2)Cc2cccnc2)cc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C31H23N3O2/c32-18-26-14-15-27(17-30(26)29-9-3-7-24-6-1-2-8-28(24)29)34(21-23-5-4-16-33-19-23)20-22-10-12-25(13-11-22)31(35)36/h1-17,19H,20-21H2,(H,35,36) |
| InChIKey | YSVQXESGFQUSEZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |