C23H21NO2S — CID 142094938
3-methyl-2-[[4-(2-naphthalen-2-ylethynyl)phenyl]sulfanylamino]butanoic acid (PubChem CID 142094938) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-methyl-2-[[4-(2-naphthalen-2-ylethynyl)phenyl]sulfanylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-(2-naphthalen-2-ylethynyl)phenyl]sulfanylamino]butanoic acid |
|---|---|
| PubChem CID | 142094938 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-methyl-2-[[4-(2-naphthalen-2-ylethynyl)phenyl]sulfanylamino]butanoic acid |
| SMILES | CC(C)C(NSc1ccc(C#Cc2ccc3ccccc3c2)cc1)C(=O)O |
| InChI | InChI=1S/C23H21NO2S/c1-16(2)22(23(25)26)24-27-21-13-10-17(11-14-21)7-8-18-9-12-19-5-3-4-6-20(19)15-18/h3-6,9-16,22,24H,1-2H3,(H,25,26) |
| InChIKey | JKISHHCCYMRNPH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|