C21H40N2O5 — CID 142096620
(2S,3aS,7aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butane;ethyl 2-(ethylamino)acetate (PubChem CID 142096620) has the molecular formula C21H40N2O5 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butane;ethyl 2-(ethylamino)acetate.
| Compound Name | (2S,3aS,7aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butane;ethyl 2-(ethylamino)acetate |
|---|---|
| PubChem CID | 142096620 |
| Molecular Formula | C21H40N2O5 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | (2S,3aS,7aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;butane;ethyl 2-(ethylamino)acetate |
| SMILES | CC(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21.CCCC.CCNCC(=O)OCC |
| InChI | InChI=1S/C11H17NO3.C6H13NO2.C4H10/c1-7(13)12-9-5-3-2-4-8(9)6-10(12)11(14)15;1-3-7-5-6(8)9-4-2;1-3-4-2/h8-10H,2-6H2,1H3,(H,14,15);7H,3-5H2,1-2H3;3-4H2,1-2H3/t8-,9-,10-;;/m0../s1 |
| InChIKey | HBVMEDSUIPKIRU-FXITZYLCSA-N |
| XLogP | 3.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |