C27H33N3O4 — CID 142097510
(3R)-2,5-dimethyl-3-[(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamoyl]hexanoic acid;prop-1-ene (PubChem CID 142097510) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (3R)-2,5-dimethyl-3-[(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamoyl]hexanoic acid;prop-1-ene.
| Compound Name | (3R)-2,5-dimethyl-3-[(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamoyl]hexanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142097510 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (3R)-2,5-dimethyl-3-[(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamoyl]hexanoic acid;prop-1-ene |
| SMILES | C=CC.CC(C)C[C@@H](C(=O)NC1N=C(c2ccccc2)c2ccccc2NC1=O)C(C)C(=O)O |
| InChI | InChI=1S/C24H27N3O4.C3H6/c1-14(2)13-18(15(3)24(30)31)22(28)27-21-23(29)25-19-12-8-7-11-17(19)20(26-21)16-9-5-4-6-10-16;1-3-2/h4-12,14-15,18,21H,13H2,1-3H3,(H,25,29)(H,27,28)(H,30,31);3H,1H2,2H3/t15?,18-,21?;/m1./s1 |
| InChIKey | DLERZBAGAPCYNV-PLRGJWQPSA-N |
| XLogP | 4.49 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|