About ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine
ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine (PubChem CID 142097620) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine.
Molecular Properties
| Compound Name | ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine |
| PubChem CID | 142097620 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine |
| SMILES | C/C=N\C(=C(/C)N)N1CCCCC1.C=C |
| InChI | InChI=1S/C10H19N3.C2H4/c1-3-12-10(9(2)11)13-7-5-4-6-8-13;1-2/h3H,4-8,11H2,1-2H3;1-2H2/b10-9-,12-3-; |
| InChIKey | XTNWNGONKIQVHP-MCPJLJCFSA-N |
| XLogP | 2.51 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine?
The IUPAC name of ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine (CID 142097620) is ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine.
What is the SMILES notation for ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine?
The canonical SMILES for ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine is C/C=N\C(=C(/C)N)N1CCCCC1.C=C.
What is the InChIKey of ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine?
The InChIKey is XTNWNGONKIQVHP-MCPJLJCFSA-N. The full InChI is InChI=1S/C10H19N3.C2H4/c1-3-12-10(9(2)11)13-7-5-4-6-8-13;1-2/h3H,4-8,11H2,1-2H3;1-2H2/b10-9-,12-3-;.
What are the key properties of ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine?
ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine has a molecular weight of 209.34 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(E)-1-[(Z)-ethylideneamino]-1-piperidin-1-ylprop-1-en-2-amine is sourced from PubChem (CID 142097620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).