C10H11N — CID 142097742
N-[(1Z)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethyl]methanimine (PubChem CID 142097742) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is N-[(1Z)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethyl]methanimine.
| Compound Name | N-[(1Z)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethyl]methanimine |
|---|---|
| PubChem CID | 142097742 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | N-[(1Z)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethyl]methanimine |
| SMILES | C=N/C(C)=c1/ccccc1=C |
| InChI | InChI=1S/C10H11N/c1-8-6-4-5-7-10(8)9(2)11-3/h4-7H,1,3H2,2H3/b10-9- |
| InChIKey | IOFMWIXBMPGJEN-KTKRTIGZSA-N |
| XLogP | 0.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|