C9H10FN — CID 70323185
N-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]methanimine (PubChem CID 70323185) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is N-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]methanimine.
| Compound Name | N-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]methanimine |
|---|---|
| PubChem CID | 70323185 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | N-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethenyl]methanimine |
| SMILES | C=NC(=C)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C9H10FN/c1-7(11-2)8-3-5-9(10)6-4-8/h3-5,9H,1-2,6H2 |
| InChIKey | SRQUEBKIMMERLA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|