C7H10ClN — CID 142097749
(Z,Z)-N-(1-chloroethenyl)-2-methylbut-2-en-1-imine (PubChem CID 142097749) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is (Z,Z)-N-(1-chloroethenyl)-2-methylbut-2-en-1-imine.
| Compound Name | (Z,Z)-N-(1-chloroethenyl)-2-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142097749 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | (Z,Z)-N-(1-chloroethenyl)-2-methylbut-2-en-1-imine |
| SMILES | C=C(Cl)/N=C\C(C)=C/C |
| InChI | InChI=1S/C7H10ClN/c1-4-6(2)5-9-7(3)8/h4-5H,3H2,1-2H3/b6-4-,9-5- |
| InChIKey | RLHTYAKIXMWTCL-QQCDKKIISA-N |
| XLogP | 2.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|