C6H10ClN — CID 123264521
3-chloro-N,2-dimethylbut-2-en-1-imine (PubChem CID 123264521) has the molecular formula C6H10ClN and a molecular weight of 131.61 g/mol. Its IUPAC name is 3-chloro-N,2-dimethylbut-2-en-1-imine.
| Compound Name | 3-chloro-N,2-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 123264521 |
| Molecular Formula | C6H10ClN |
| Molecular Weight | 131.61 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 3-chloro-N,2-dimethylbut-2-en-1-imine |
| SMILES | C/N=C/C(C)=C(C)Cl |
| InChI | InChI=1S/C6H10ClN/c1-5(4-8-3)6(2)7/h4H,1-3H3/b6-5?,8-4+ |
| InChIKey | ATSIXKBIWXJKPJ-KEFBPMMISA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|