C21H28ClFN2O6 — CID 142098623
2-(2-chlorophenyl)ethyl formate;5-fluoro-3-[(1-methylpiperidine-2-carbonyl)amino]-4-oxopentanoic acid (PubChem CID 142098623) has the molecular formula C21H28ClFN2O6 and a molecular weight of 458.91 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl formate;5-fluoro-3-[(1-methylpiperidine-2-carbonyl)amino]-4-oxopentanoic acid.
| Compound Name | 2-(2-chlorophenyl)ethyl formate;5-fluoro-3-[(1-methylpiperidine-2-carbonyl)amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142098623 |
| Molecular Formula | C21H28ClFN2O6 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl formate;5-fluoro-3-[(1-methylpiperidine-2-carbonyl)amino]-4-oxopentanoic acid |
| SMILES | CN1CCCCC1C(=O)NC(CC(=O)O)C(=O)CF.O=COCCc1ccccc1Cl |
| InChI | InChI=1S/C12H19FN2O4.C9H9ClO2/c1-15-5-3-2-4-9(15)12(19)14-8(6-11(17)18)10(16)7-13;10-9-4-2-1-3-8(9)5-6-12-7-11/h8-9H,2-7H2,1H3,(H,14,19)(H,17,18);1-4,7H,5-6H2 |
| InChIKey | RHZSKXPKJRFRNY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|