About ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole
ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole (PubChem CID 142088482) has the molecular formula C23H27FN2O6
and a molecular weight of 446.48 g/mol. Its IUPAC name is ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole.
Molecular Properties
| Compound Name | ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole |
| PubChem CID | 142088482 |
| Molecular Formula | C23H27FN2O6 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole |
| SMILES | CC.Cn1c2ccccc2c2ccccc21.O=COCC(=O)NC(CC(=O)O)C(=O)CF |
| InChI | InChI=1S/C13H11N.C8H10FNO6.C2H6/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;9-2-6(12)5(1-8(14)15)10-7(13)3-16-4-11;1-2/h2-9H,1H3;4-5H,1-3H2,(H,10,13)(H,14,15);1-2H3 |
| InChIKey | RQPOIDFEBKUSFP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole?
The IUPAC name of ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole (CID 142088482) is ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole.
What is the SMILES notation for ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole?
The canonical SMILES for ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole is CC.Cn1c2ccccc2c2ccccc21.O=COCC(=O)NC(CC(=O)O)C(=O)CF.
What is the InChIKey of ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole?
The InChIKey is RQPOIDFEBKUSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.C8H10FNO6.C2H6/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;9-2-6(12)5(1-8(14)15)10-7(13)3-16-4-11;1-2/h2-9H,1H3;4-5H,1-3H2,(H,10,13)(H,14,15);1-2H3.
What are the key properties of ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole?
ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole has a molecular weight of 446.48 g/mol, XLogP of 3.02, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-3-[(2-formyloxyacetyl)amino]-4-oxopentanoic acid;9-methylcarbazole is sourced from PubChem (CID 142088482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).