C22H22FN3O6 — CID 23535529
5-fluoro-3-[2-(10-methylphenazine-5-carbonyl)oxypropanoylamino]-4-oxopentanoic acid (PubChem CID 23535529) has the molecular formula C22H22FN3O6 and a molecular weight of 443.43 g/mol. Its IUPAC name is 5-fluoro-3-[2-(10-methylphenazine-5-carbonyl)oxypropanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-fluoro-3-[2-(10-methylphenazine-5-carbonyl)oxypropanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 23535529 |
| Molecular Formula | C22H22FN3O6 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 5-fluoro-3-[2-(10-methylphenazine-5-carbonyl)oxypropanoylamino]-4-oxopentanoic acid |
| SMILES | CC(OC(=O)N1c2ccccc2N(C)c2ccccc21)C(=O)NC(CC(=O)O)C(=O)CF |
| InChI | InChI=1S/C22H22FN3O6/c1-13(21(30)24-14(11-20(28)29)19(27)12-23)32-22(31)26-17-9-5-3-7-15(17)25(2)16-8-4-6-10-18(16)26/h3-10,13-14H,11-12H2,1-2H3,(H,24,30)(H,28,29) |
| InChIKey | ZCWLETCBIXPYFA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |