C18H23ClN2O — CID 142099011
4-[[2-[benzyl(methyl)amino]ethyl-methylamino]methyl]-2-chlorophenol (PubChem CID 142099011) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 4-[[2-[benzyl(methyl)amino]ethyl-methylamino]methyl]-2-chlorophenol.
| Compound Name | 4-[[2-[benzyl(methyl)amino]ethyl-methylamino]methyl]-2-chlorophenol |
|---|---|
| PubChem CID | 142099011 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-[[2-[benzyl(methyl)amino]ethyl-methylamino]methyl]-2-chlorophenol |
| SMILES | CN(CCN(C)Cc1ccc(O)c(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C18H23ClN2O/c1-20(13-15-6-4-3-5-7-15)10-11-21(2)14-16-8-9-18(22)17(19)12-16/h3-9,12,22H,10-11,13-14H2,1-2H3 |
| InChIKey | RTOXJRNZZZXUNJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |