C11H13ClF3NO — CID 82981036
2-chloro-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]phenol (PubChem CID 82981036) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 2-chloro-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]phenol.
| Compound Name | 2-chloro-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82981036 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-chloro-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]phenol |
| SMILES | CN(CCC(F)(F)F)Cc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClF3NO/c1-16(5-4-11(13,14)15)7-8-2-3-10(17)9(12)6-8/h2-3,6,17H,4-5,7H2,1H3 |
| InChIKey | OPJNWRCFIFSKNR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |