About 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide
1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide (PubChem CID 142099817) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide |
| PubChem CID | 142099817 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CNC(=O)[C@H](CC(C)(C)C)C1(C(N)=O)CCCCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-14(2,3)10-11(12(18)17-4)15(13(16)19)8-6-5-7-9-15/h11H,5-10H2,1-4H3,(H2,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | QEIAMMPIRWZULS-NSHDSACASA-N |
| XLogP | 2.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide?
The IUPAC name of 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide (CID 142099817) is 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide.
What is the SMILES notation for 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide?
The canonical SMILES for 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide is CNC(=O)[C@H](CC(C)(C)C)C1(C(N)=O)CCCCC1.
What is the InChIKey of 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide?
The InChIKey is QEIAMMPIRWZULS-NSHDSACASA-N. The full InChI is InChI=1S/C15H28N2O2/c1-14(2,3)10-11(12(18)17-4)15(13(16)19)8-6-5-7-9-15/h11H,5-10H2,1-4H3,(H2,16,19)(H,17,18)/t11-/m0/s1.
What are the key properties of 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide?
1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide has a molecular weight of 268.40 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]cyclohexane-1-carboxamide is sourced from PubChem (CID 142099817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).