C12H27N3 — CID 14210025
1-(2-aminoethyl)-N,N-diethylazepan-3-amine (PubChem CID 14210025) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N,N-diethylazepan-3-amine.
| Compound Name | 1-(2-aminoethyl)-N,N-diethylazepan-3-amine |
|---|---|
| PubChem CID | 14210025 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1-(2-aminoethyl)-N,N-diethylazepan-3-amine |
| SMILES | CCN(CC)C1CCCCN(CCN)C1 |
| InChI | InChI=1S/C12H27N3/c1-3-15(4-2)12-7-5-6-9-14(11-12)10-8-13/h12H,3-11,13H2,1-2H3 |
| InChIKey | MIYRAHRFBYEAIZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |