About 1-(2-aminoethyl)-N,N-diethylazepan-3-amine
1-(2-aminoethyl)-N,N-diethylazepan-3-amine (PubChem CID 14210025) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N,N-diethylazepan-3-amine.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-N,N-diethylazepan-3-amine |
| PubChem CID | 14210025 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1-(2-aminoethyl)-N,N-diethylazepan-3-amine |
| SMILES | CCN(CC)C1CCCCN(CCN)C1 |
| InChI | InChI=1S/C12H27N3/c1-3-15(4-2)12-7-5-6-9-14(11-12)10-8-13/h12H,3-11,13H2,1-2H3 |
| InChIKey | MIYRAHRFBYEAIZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-aminoethyl)-N,N-diethylazepan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-N,N-diethylazepan-3-amine?
The IUPAC name of 1-(2-aminoethyl)-N,N-diethylazepan-3-amine (CID 14210025) is 1-(2-aminoethyl)-N,N-diethylazepan-3-amine.
What is the SMILES notation for 1-(2-aminoethyl)-N,N-diethylazepan-3-amine?
The canonical SMILES for 1-(2-aminoethyl)-N,N-diethylazepan-3-amine is CCN(CC)C1CCCCN(CCN)C1.
What is the InChIKey of 1-(2-aminoethyl)-N,N-diethylazepan-3-amine?
The InChIKey is MIYRAHRFBYEAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3/c1-3-15(4-2)12-7-5-6-9-14(11-12)10-8-13/h12H,3-11,13H2,1-2H3.
What are the key properties of 1-(2-aminoethyl)-N,N-diethylazepan-3-amine?
1-(2-aminoethyl)-N,N-diethylazepan-3-amine has a molecular weight of 213.37 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-N,N-diethylazepan-3-amine is sourced from PubChem (CID 14210025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).