C24H32N6O2 — CID 14210031
N-[3-[2-[(dimethylamino)methyl]piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepine-11-carboxamide (PubChem CID 14210031) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[3-[2-[(dimethylamino)methyl]piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepine-11-carboxamide.
| Compound Name | N-[3-[2-[(dimethylamino)methyl]piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepine-11-carboxamide |
|---|---|
| PubChem CID | 14210031 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-[3-[2-[(dimethylamino)methyl]piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepine-11-carboxamide |
| SMILES | CN(C)CC1CCCCN1CCCNC(=O)N1c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C24H32N6O2/c1-28(2)17-18-9-5-6-15-29(18)16-8-14-26-24(32)30-21-12-4-3-10-19(21)23(31)27-20-11-7-13-25-22(20)30/h3-4,7,10-13,18H,5-6,8-9,14-17H2,1-2H3,(H,26,32)(H,27,31) |
| InChIKey | AEQVSLIFDCWNGE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|