C27H37N5O2 — CID 70411121
N-[3-[2-(diethylaminomethyl)piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1]benzazepine-11-carboxamide (PubChem CID 70411121) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-[3-[2-(diethylaminomethyl)piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1]benzazepine-11-carboxamide.
| Compound Name | N-[3-[2-(diethylaminomethyl)piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1]benzazepine-11-carboxamide |
|---|---|
| PubChem CID | 70411121 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | N-[3-[2-(diethylaminomethyl)piperidin-1-yl]propyl]-6-oxo-5H-pyrido[2,3-b][1]benzazepine-11-carboxamide |
| SMILES | CCN(CC)CC1CCCCN1CCCNC(=O)N1c2ccccc2C(=O)Cc2cccnc21 |
| InChI | InChI=1S/C27H37N5O2/c1-3-30(4-2)20-22-12-7-8-17-31(22)18-10-16-29-27(34)32-24-14-6-5-13-23(24)25(33)19-21-11-9-15-28-26(21)32/h5-6,9,11,13-15,22H,3-4,7-8,10,12,16-20H2,1-2H3,(H,29,34) |
| InChIKey | AVIBIDNNSYGSCI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|