C4H11N2O7PS — CID 142100359
[[2-(hydroxyamino)-2-oxoethyl]-methylsulfonylamino]methylphosphonic acid (PubChem CID 142100359) has the molecular formula C4H11N2O7PS and a molecular weight of 262.18 g/mol. Its IUPAC name is [[2-(hydroxyamino)-2-oxoethyl]-methylsulfonylamino]methylphosphonic acid.
| Compound Name | [[2-(hydroxyamino)-2-oxoethyl]-methylsulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 142100359 |
| Molecular Formula | C4H11N2O7PS |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | [[2-(hydroxyamino)-2-oxoethyl]-methylsulfonylamino]methylphosphonic acid |
| SMILES | CS(=O)(=O)N(CC(=O)NO)CP(=O)(O)O |
| InChI | InChI=1S/C4H11N2O7PS/c1-15(12,13)6(2-4(7)5-8)3-14(9,10)11/h8H,2-3H2,1H3,(H,5,7)(H2,9,10,11) |
| InChIKey | KPJGOFROVAMYJE-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|