C12H19N2O5P — CID 142100389
[[2-(hydroxyamino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]amino]methyl-methylphosphinic acid (PubChem CID 142100389) has the molecular formula C12H19N2O5P and a molecular weight of 302.27 g/mol. Its IUPAC name is [[2-(hydroxyamino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]amino]methyl-methylphosphinic acid.
| Compound Name | [[2-(hydroxyamino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]amino]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 142100389 |
| Molecular Formula | C12H19N2O5P |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [[2-(hydroxyamino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]amino]methyl-methylphosphinic acid |
| SMILES | COc1ccc(CN(CC(=O)NO)CP(C)(=O)O)cc1 |
| InChI | InChI=1S/C12H19N2O5P/c1-19-11-5-3-10(4-6-11)7-14(8-12(15)13-16)9-20(2,17)18/h3-6,16H,7-9H2,1-2H3,(H,13,15)(H,17,18) |
| InChIKey | SNYNEQLNXIADGX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|