C22H22ClN3O3 — CID 142101354
benzyl N-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]-N-cyclopentylcarbamate (PubChem CID 142101354) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is benzyl N-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]-N-cyclopentylcarbamate.
| Compound Name | benzyl N-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]-N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 142101354 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | benzyl N-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]-N-cyclopentylcarbamate |
| SMILES | N#CC(NC(=O)N(C(=O)OCc1ccccc1)C1CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-18-10-6-9-17(13-18)20(14-24)25-21(27)26(19-11-4-5-12-19)22(28)29-15-16-7-2-1-3-8-16/h1-3,6-10,13,19-20H,4-5,11-12,15H2,(H,25,27) |
| InChIKey | ZUIDWKOQORLJGG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |