C21H20ClN3O3 — CID 59044320
benzyl (2S)-2-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 59044320) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is benzyl (2S)-2-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59044320 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | benzyl (2S)-2-[[(3-chlorophenyl)-cyanomethyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | N#CC(NC(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c22-17-9-4-8-16(12-17)18(13-23)24-20(26)19-10-5-11-25(19)21(27)28-14-15-6-2-1-3-7-15/h1-4,6-9,12,18-19H,5,10-11,14H2,(H,24,26)/t18?,19-/m0/s1 |
| InChIKey | WBWOTEKYVKEOBM-GGYWPGCISA-N |
| XLogP | 3.82 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |