C14H21N3 — CID 142101610
(2E,3E,5Z)-2-ethylidene-4-(4-methylpiperazin-1-yl)hepta-3,5-dienenitrile (PubChem CID 142101610) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (2E,3E,5Z)-2-ethylidene-4-(4-methylpiperazin-1-yl)hepta-3,5-dienenitrile.
| Compound Name | (2E,3E,5Z)-2-ethylidene-4-(4-methylpiperazin-1-yl)hepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 142101610 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (2E,3E,5Z)-2-ethylidene-4-(4-methylpiperazin-1-yl)hepta-3,5-dienenitrile |
| SMILES | C/C=C\C(=C/C(C#N)=C\C)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H21N3/c1-4-6-14(11-13(5-2)12-15)17-9-7-16(3)8-10-17/h4-6,11H,7-10H2,1-3H3/b6-4-,13-5+,14-11+ |
| InChIKey | LAQORRVYLGGOQS-FQMYLEAHSA-N |
| XLogP | 2.16 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|