C17H16N4O5S — CID 1421027
(5S)-11-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 1421027) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is (5S)-11-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5S)-11-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 1421027 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (5S)-11-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CN1CCc2c(sc3c2C(=O)N[C@H](c2cc4c(cc2[N+](=O)[O-])OCO4)N3)C1 |
| InChI | InChI=1S/C17H16N4O5S/c1-20-3-2-8-13(6-20)27-17-14(8)16(22)18-15(19-17)9-4-11-12(26-7-25-11)5-10(9)21(23)24/h4-5,15,19H,2-3,6-7H2,1H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | AXZKTRBBTDORCU-HNNXBMFYSA-N |
| XLogP | 2.23 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|