C22H19N5O6S — CID 3785933
5-[3-(2,4-dinitrophenoxy)phenyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3785933) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is 5-[3-(2,4-dinitrophenoxy)phenyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 5-[3-(2,4-dinitrophenoxy)phenyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3785933 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 5-[3-(2,4-dinitrophenoxy)phenyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CN1CCc2c(sc3c2C(=O)NC(c2cccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c2)N3)C1 |
| InChI | InChI=1S/C22H19N5O6S/c1-25-8-7-15-18(11-25)34-22-19(15)21(28)23-20(24-22)12-3-2-4-14(9-12)33-17-6-5-13(26(29)30)10-16(17)27(31)32/h2-6,9-10,20,24H,7-8,11H2,1H3,(H,23,28) |
| InChIKey | IUFXRPNIURFKLD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|