C24H21N5O8S — CID 98285028
ethyl (5R)-5-[3-(2,4-dinitrophenoxy)phenyl]-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 98285028) has the molecular formula C24H21N5O8S and a molecular weight of 539.53 g/mol. Its IUPAC name is ethyl (5R)-5-[3-(2,4-dinitrophenoxy)phenyl]-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl (5R)-5-[3-(2,4-dinitrophenoxy)phenyl]-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 98285028 |
| Molecular Formula | C24H21N5O8S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | ethyl (5R)-5-[3-(2,4-dinitrophenoxy)phenyl]-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)N[C@@H](c2cccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c2)N3)C1 |
| InChI | InChI=1S/C24H21N5O8S/c1-2-36-24(31)27-9-8-16-19(12-27)38-23-20(16)22(30)25-21(26-23)13-4-3-5-15(10-13)37-18-7-6-14(28(32)33)11-17(18)29(34)35/h3-7,10-11,21,26H,2,8-9,12H2,1H3,(H,25,30)/t21-/m1/s1 |
| InChIKey | MKHRFIWFIOWIEA-OAQYLSRUSA-N |
| XLogP | 4.73 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|