C18H17BrN4O5S — CID 40874542
ethyl (5R)-5-(4-bromo-3-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 40874542) has the molecular formula C18H17BrN4O5S and a molecular weight of 481.33 g/mol. Its IUPAC name is ethyl (5R)-5-(4-bromo-3-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl (5R)-5-(4-bromo-3-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 40874542 |
| Molecular Formula | C18H17BrN4O5S |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | ethyl (5R)-5-(4-bromo-3-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(Br)c([N+](=O)[O-])c2)N3)C1 |
| InChI | InChI=1S/C18H17BrN4O5S/c1-2-28-18(25)22-6-5-10-13(8-22)29-17-14(10)16(24)20-15(21-17)9-3-4-11(19)12(7-9)23(26)27/h3-4,7,15,21H,2,5-6,8H2,1H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | DBPDBAGSCJIXQF-OAHLLOKOSA-N |
| XLogP | 3.79 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|