C18H16Br3N3O4S — CID 3710347
ethyl 3-oxo-5-(2,4,6-tribromo-3-hydroxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 3710347) has the molecular formula C18H16Br3N3O4S and a molecular weight of 610.12 g/mol. Its IUPAC name is ethyl 3-oxo-5-(2,4,6-tribromo-3-hydroxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl 3-oxo-5-(2,4,6-tribromo-3-hydroxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 3710347 |
| Molecular Formula | C18H16Br3N3O4S |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 606.84 |
| IUPAC Name | ethyl 3-oxo-5-(2,4,6-tribromo-3-hydroxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)NC(c2c(Br)cc(Br)c(O)c2Br)N3)C1 |
| InChI | InChI=1S/C18H16Br3N3O4S/c1-2-28-18(27)24-4-3-7-10(6-24)29-17-11(7)16(26)22-15(23-17)12-8(19)5-9(20)14(25)13(12)21/h5,15,23,25H,2-4,6H2,1H3,(H,22,26) |
| InChIKey | KDGUWCBESITPSQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |