C18H17Cl2N3O3S — CID 40796456
ethyl (5S)-5-(2,6-dichlorophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 40796456) has the molecular formula C18H17Cl2N3O3S and a molecular weight of 426.33 g/mol. Its IUPAC name is ethyl (5S)-5-(2,6-dichlorophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl (5S)-5-(2,6-dichlorophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 40796456 |
| Molecular Formula | C18H17Cl2N3O3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | ethyl (5S)-5-(2,6-dichlorophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)N[C@H](c2c(Cl)cccc2Cl)N3)C1 |
| InChI | InChI=1S/C18H17Cl2N3O3S/c1-2-26-18(25)23-7-6-9-12(8-23)27-17-13(9)16(24)21-15(22-17)14-10(19)4-3-5-11(14)20/h3-5,15,22H,2,6-8H2,1H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | MBGCIRFWDOTVSW-HNNXBMFYSA-N |
| XLogP | 4.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |