C18H17Cl2N3O4S — CID 3716515
ethyl 5-(3,5-dichloro-2-hydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 3716515) has the molecular formula C18H17Cl2N3O4S and a molecular weight of 442.32 g/mol. Its IUPAC name is ethyl 5-(3,5-dichloro-2-hydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl 5-(3,5-dichloro-2-hydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 3716515 |
| Molecular Formula | C18H17Cl2N3O4S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | ethyl 5-(3,5-dichloro-2-hydroxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)NC(c2cc(Cl)cc(Cl)c2O)N3)C1 |
| InChI | InChI=1S/C18H17Cl2N3O4S/c1-2-27-18(26)23-4-3-9-12(7-23)28-17-13(9)16(25)21-15(22-17)10-5-8(19)6-11(20)14(10)24/h5-6,15,22,24H,2-4,7H2,1H3,(H,21,25) |
| InChIKey | PLZNOSVHGSBBRB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|