C19H20N4O7S — CID 3737815
ethyl 5-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 3737815) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is ethyl 5-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl 5-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 3737815 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | ethyl 5-(4-hydroxy-3-methoxy-2-nitrophenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)NC(c2ccc(O)c(OC)c2[N+](=O)[O-])N3)C1 |
| InChI | InChI=1S/C19H20N4O7S/c1-3-30-19(26)22-7-6-9-12(8-22)31-18-13(9)17(25)20-16(21-18)10-4-5-11(24)15(29-2)14(10)23(27)28/h4-5,16,21,24H,3,6-8H2,1-2H3,(H,20,25) |
| InChIKey | NWNJBZWPUTZAES-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|