C28H29N3O8S — CID 4662806
ethyl 3-oxo-5-[2-(3,4,5-trimethoxybenzoyl)oxyphenyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate (PubChem CID 4662806) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is ethyl 3-oxo-5-[2-(3,4,5-trimethoxybenzoyl)oxyphenyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate.
| Compound Name | ethyl 3-oxo-5-[2-(3,4,5-trimethoxybenzoyl)oxyphenyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
|---|---|
| PubChem CID | 4662806 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | ethyl 3-oxo-5-[2-(3,4,5-trimethoxybenzoyl)oxyphenyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3c2C(=O)NC(c2ccccc2OC(=O)c2cc(OC)c(OC)c(OC)c2)N3)C1 |
| InChI | InChI=1S/C28H29N3O8S/c1-5-38-28(34)31-11-10-17-21(14-31)40-26-22(17)25(32)29-24(30-26)16-8-6-7-9-18(16)39-27(33)15-12-19(35-2)23(37-4)20(13-15)36-3/h6-9,12-13,24,30H,5,10-11,14H2,1-4H3,(H,29,32) |
| InChIKey | PCGGVRHVJGPYPX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|