C27H29N3O6S — CID 40878597
[4-[(5S)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 40878597) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is [4-[(5S)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(5S)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 40878597 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [4-[(5S)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCN1CCc2c(sc3c2C(=O)N[C@H](c2ccc(OC(=O)c4cc(OC)c(OC)c(OC)c4)cc2)N3)C1 |
| InChI | InChI=1S/C27H29N3O6S/c1-5-30-11-10-18-21(14-30)37-26-22(18)25(31)28-24(29-26)15-6-8-17(9-7-15)36-27(32)16-12-19(33-2)23(35-4)20(13-16)34-3/h6-9,12-13,24,29H,5,10-11,14H2,1-4H3,(H,28,31)/t24-/m0/s1 |
| InChIKey | QXNFGLXJVZEDND-DEOSSOPVSA-N |
| XLogP | 4.23 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|