C32H31N3O6S — CID 3501345
[3-(11-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3501345) has the molecular formula C32H31N3O6S and a molecular weight of 585.68 g/mol. Its IUPAC name is [3-(11-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-(11-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3501345 |
| Molecular Formula | C32H31N3O6S |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [3-(11-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cccc(C3NC(=O)c4c(sc5c4CCN(Cc4ccccc4)C5)N3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H31N3O6S/c1-38-24-15-21(16-25(39-2)28(24)40-3)32(37)41-22-11-7-10-20(14-22)29-33-30(36)27-23-12-13-35(17-19-8-5-4-6-9-19)18-26(23)42-31(27)34-29/h4-11,14-16,29,34H,12-13,17-18H2,1-3H3,(H,33,36) |
| InChIKey | ACODIZANSZZNSO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|