C30H34N2O6S — CID 98279021
[3-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 98279021) has the molecular formula C30H34N2O6S and a molecular weight of 550.68 g/mol. Its IUPAC name is [3-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 98279021 |
| Molecular Formula | C30H34N2O6S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [3-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cccc([C@@H]3NC(=O)c4c(sc5c4CC[C@@H](C(C)(C)C)C5)N3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H34N2O6S/c1-30(2,3)18-10-11-20-23(15-18)39-28-24(20)27(33)31-26(32-28)16-8-7-9-19(12-16)38-29(34)17-13-21(35-4)25(37-6)22(14-17)36-5/h7-9,12-14,18,26,32H,10-11,15H2,1-6H3,(H,31,33)/t18-,26-/m1/s1 |
| InChIKey | BGUZDWLJRXXHKG-WXTAPIANSA-N |
| XLogP | 6.00 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|