C28H30N2O3S — CID 40873521
[3-[(2S,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] benzoate (PubChem CID 40873521) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is [3-[(2S,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] benzoate.
| Compound Name | [3-[(2S,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 40873521 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [3-[(2S,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] benzoate |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@H](c2cccc(OC(=O)c4ccccc4)c2)N3)C1 |
| InChI | InChI=1S/C28H30N2O3S/c1-4-28(2,3)19-13-14-21-22(16-19)34-26-23(21)25(31)29-24(30-26)18-11-8-12-20(15-18)33-27(32)17-9-6-5-7-10-17/h5-12,15,19,24,30H,4,13-14,16H2,1-3H3,(H,29,31)/t19-,24+/m1/s1 |
| InChIKey | XPKGHSVVCLGOIJ-DVECYGJZSA-N |
| XLogP | 6.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|