C28H32N2O4S2 — CID 40873492
[2-ethoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 40873492) has the molecular formula C28H32N2O4S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is [2-ethoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 40873492 |
| Molecular Formula | C28H32N2O4S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | [2-ethoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc([C@@H]2NC(=O)c3c(sc4c3CC[C@@H](C(C)(C)CC)C4)N2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C28H32N2O4S2/c1-5-28(3,4)17-10-11-18-22(15-17)36-26-23(18)25(31)29-24(30-26)16-9-12-19(20(14-16)33-6-2)34-27(32)21-8-7-13-35-21/h7-9,12-14,17,24,30H,5-6,10-11,15H2,1-4H3,(H,29,31)/t17-,24-/m1/s1 |
| InChIKey | NXJPNYYLNOTJHK-MZNJEOGPSA-N |
| XLogP | 6.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|