C29H32N2O4S — CID 27523748
[4-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-ethoxyphenyl] benzoate (PubChem CID 27523748) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is [4-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 27523748 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [4-[(2R,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc([C@@H]2NC(=O)c3c(sc4c3CC[C@@H](C(C)(C)C)C4)N2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O4S/c1-5-34-22-15-18(11-14-21(22)35-28(33)17-9-7-6-8-10-17)25-30-26(32)24-20-13-12-19(29(2,3)4)16-23(20)36-27(24)31-25/h6-11,14-15,19,25,31H,5,12-13,16H2,1-4H3,(H,30,32)/t19-,25-/m1/s1 |
| InChIKey | YPKRJLJFXSRFLB-KBMIEXCESA-N |
| XLogP | 6.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|