C29H30N2O6S — CID 98279116
[4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 98279116) has the molecular formula C29H30N2O6S and a molecular weight of 534.63 g/mol. Its IUPAC name is [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 98279116 |
| Molecular Formula | C29H30N2O6S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc([C@@H]2NC(=O)c3c(sc4c3CC[C@H](C(C)(C)C)C4)N2)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H30N2O6S/c1-29(2,3)17-7-8-18-23(13-17)38-27-24(18)26(32)30-25(31-27)15-5-10-20(21(11-15)34-4)37-28(33)16-6-9-19-22(12-16)36-14-35-19/h5-6,9-12,17,25,31H,7-8,13-14H2,1-4H3,(H,30,32)/t17-,25+/m0/s1 |
| InChIKey | ZQKAQPASTTYMOG-SSOJOUAXSA-N |
| XLogP | 5.71 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|