C27H27N3O6S — CID 40875447
[2-methoxy-4-[(5R)-3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 40875447) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is [2-methoxy-4-[(5R)-3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-methoxy-4-[(5R)-3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 40875447 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [2-methoxy-4-[(5R)-3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc([C@@H]2NC(=O)c3c(sc4c3CCN(C(C)C)C4)N2)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H27N3O6S/c1-14(2)30-9-8-17-22(12-30)37-26-23(17)25(31)28-24(29-26)15-4-7-19(20(10-15)33-3)36-27(32)16-5-6-18-21(11-16)35-13-34-18/h4-7,10-11,14,24,29H,8-9,12-13H2,1-3H3,(H,28,31)/t24-/m1/s1 |
| InChIKey | PPGOIHFQEJNFNF-XMMPIXPASA-N |
| XLogP | 4.33 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|