C29H32N2O5S — CID 27523799
[4-[(2S,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate (PubChem CID 27523799) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is [4-[(2S,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[(2S,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 27523799 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [4-[(2S,7R)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc([C@H]3NC(=O)c4c(sc5c4CC[C@@H](C(C)(C)C)C5)N3)cc2OC)cc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-29(2,3)18-9-12-20-23(15-18)37-27-24(20)26(32)30-25(31-27)17-8-13-21(22(14-17)35-5)36-28(33)16-6-10-19(34-4)11-7-16/h6-8,10-11,13-14,18,25,31H,9,12,15H2,1-5H3,(H,30,32)/t18-,25+/m1/s1 |
| InChIKey | OBXHKUHVXDTBRN-CJAUYULYSA-N |
| XLogP | 5.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|