C31H36N2O3S — CID 41339328
[4-[(2S,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-tert-butylbenzoate (PubChem CID 41339328) has the molecular formula C31H36N2O3S and a molecular weight of 516.71 g/mol. Its IUPAC name is [4-[(2S,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(2S,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 41339328 |
| Molecular Formula | C31H36N2O3S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [4-[(2S,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2ccc([C@H]3NC(=O)c4c(sc5c4CC[C@H](C(C)(C)C)C5)N3)cc2)cc1 |
| InChI | InChI=1S/C31H36N2O3S/c1-30(2,3)20-11-7-19(8-12-20)29(35)36-22-14-9-18(10-15-22)26-32-27(34)25-23-16-13-21(31(4,5)6)17-24(23)37-28(25)33-26/h7-12,14-15,21,26,33H,13,16-17H2,1-6H3,(H,32,34)/t21-,26-/m0/s1 |
| InChIKey | FIEVNUSACFLYRE-LVXARBLLSA-N |
| XLogP | 7.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|