C24H21ClN2O3S — CID 26876367
[4-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate (PubChem CID 26876367) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is [4-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 26876367 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [4-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate |
| SMILES | C[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(OC(=O)c4ccc(Cl)cc4)cc2)N3)C1 |
| InChI | InChI=1S/C24H21ClN2O3S/c1-13-2-11-18-19(12-13)31-23-20(18)22(28)26-21(27-23)14-5-9-17(10-6-14)30-24(29)15-3-7-16(25)8-4-15/h3-10,13,21,27H,2,11-12H2,1H3,(H,26,28)/t13-,21-/m1/s1 |
| InChIKey | YGBUCHWYAUBILH-LRTDBIEQSA-N |
| XLogP | 5.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|