C22H20N2O4S — CID 7287832
[4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] furan-2-carboxylate (PubChem CID 7287832) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7287832 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] furan-2-carboxylate |
| SMILES | C[C@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(OC(=O)c4ccco4)cc2)N3)C1 |
| InChI | InChI=1S/C22H20N2O4S/c1-12-4-9-15-17(11-12)29-21-18(15)20(25)23-19(24-21)13-5-7-14(8-6-13)28-22(26)16-3-2-10-27-16/h2-3,5-8,10,12,19,24H,4,9,11H2,1H3,(H,23,25)/t12-,19+/m0/s1 |
| InChIKey | UCGWJMPFGDJVPT-HXPMCKFVSA-N |
| XLogP | 4.54 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|