C27H26N2O4S — CID 26876240
[4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 26876240) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 26876240 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [4-[(2R,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc([C@@H]3NC(=O)c4c(sc5c4CC[C@H](C)C5)N3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O4S/c1-16-3-13-21-22(15-16)34-27-24(21)26(31)28-25(29-27)18-7-11-20(12-8-18)33-23(30)14-6-17-4-9-19(32-2)10-5-17/h4-12,14,16,25,29H,3,13,15H2,1-2H3,(H,28,31)/b14-6+/t16-,25+/m0/s1 |
| InChIKey | HJHXAMYBDYSXAP-SJZVDKCFSA-N |
| XLogP | 5.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|