C31H30N2O3S — CID 41339297
[4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] naphthalene-1-carboxylate (PubChem CID 41339297) has the molecular formula C31H30N2O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 41339297 |
| Molecular Formula | C31H30N2O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [4-[(2R,7S)-7-tert-butyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] naphthalene-1-carboxylate |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(OC(=O)c4cccc5ccccc45)cc2)N3)C1 |
| InChI | InChI=1S/C31H30N2O3S/c1-31(2,3)20-13-16-24-25(17-20)37-29-26(24)28(34)32-27(33-29)19-11-14-21(15-12-19)36-30(35)23-10-6-8-18-7-4-5-9-22(18)23/h4-12,14-15,20,27,33H,13,16-17H2,1-3H3,(H,32,34)/t20-,27+/m0/s1 |
| InChIKey | DIGJVGUQDZGHFV-CCLHPLFOSA-N |
| XLogP | 7.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|