C29H31ClN2O4S — CID 98151118
[2-methoxy-4-[(2R,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate (PubChem CID 98151118) has the molecular formula C29H31ClN2O4S and a molecular weight of 539.10 g/mol. Its IUPAC name is [2-methoxy-4-[(2R,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(2R,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 98151118 |
| Molecular Formula | C29H31ClN2O4S |
| Molecular Weight | 539.10 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | [2-methoxy-4-[(2R,7S)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-chlorobenzoate |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(OC(=O)c4ccc(Cl)cc4)c(OC)c2)N3)C1 |
| InChI | InChI=1S/C29H31ClN2O4S/c1-5-29(2,3)18-9-12-20-23(15-18)37-27-24(20)26(33)31-25(32-27)17-8-13-21(22(14-17)35-4)36-28(34)16-6-10-19(30)11-7-16/h6-8,10-11,13-14,18,25,32H,5,9,12,15H2,1-4H3,(H,31,33)/t18-,25+/m0/s1 |
| InChIKey | HJFWUQIOXKKVHH-AVRWGWEMSA-N |
| XLogP | 7.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.10 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|