C30H33BrN2O4S — CID 98151133
[2-bromo-6-methoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-methylbenzoate (PubChem CID 98151133) has the molecular formula C30H33BrN2O4S and a molecular weight of 597.58 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-methylbenzoate.
| Compound Name | [2-bromo-6-methoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 98151133 |
| Molecular Formula | C30H33BrN2O4S |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(2R,7R)-7-(2-methylbutan-2-yl)-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-methylbenzoate |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Br)c(OC(=O)c4ccc(C)cc4)c(OC)c2)N3)C1 |
| InChI | InChI=1S/C30H33BrN2O4S/c1-6-30(3,4)19-11-12-20-23(15-19)38-28-24(20)27(34)32-26(33-28)18-13-21(31)25(22(14-18)36-5)37-29(35)17-9-7-16(2)8-10-17/h7-10,13-14,19,26,33H,6,11-12,15H2,1-5H3,(H,32,34)/t19-,26-/m1/s1 |
| InChIKey | ROSNWTCIHGXAIE-NIYFSFCBSA-N |
| XLogP | 7.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|