C23H30N2O3S — CID 7280859
(2S,7R)-2-(2,5-dimethoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7280859) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (2S,7R)-2-(2,5-dimethoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7R)-2-(2,5-dimethoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7280859 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S,7R)-2-(2,5-dimethoxyphenyl)-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@H](c2cc(OC)ccc2OC)N3)C1 |
| InChI | InChI=1S/C23H30N2O3S/c1-6-23(2,3)13-7-9-15-18(11-13)29-22-19(15)21(26)24-20(25-22)16-12-14(27-4)8-10-17(16)28-5/h8,10,12-13,20,25H,6-7,9,11H2,1-5H3,(H,24,26)/t13-,20+/m1/s1 |
| InChIKey | GNPZGDUCNOJVCQ-XCLFUZPHSA-N |
| XLogP | 5.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |